191-24-2 Benzo[ghi]perylene
| product Name |
Benzo[ghi]perylene |
| CAS No |
191-24-2 |
| Synonyms |
1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
| Molecular Formula |
C22H12 |
| Molecular Weight |
276.3307 |
| InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
| EINECS |
205-883-8 |
| Molecular Structure |
|
| Density |
1.378g/cm3 |
| Melting point |
276-280℃ |
| Boiling point |
501°C at 760 mmHg |
| Refractive index |
2.009 |
| Flash point |
247.2°C |
| Vapour Pressur |
1.12E-09mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Gu Xiaoxing |
| Telephone |
+86-519-86461196;86464994 |
| Email |
gxx@xingshengtech.com;gxy@xingshengtech.com |
| Address |
Miaoqiao St.,Wujin District,Changzhou City, Jiangsu, China. |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Shelley Qian |
| Telephone |
021-57857285 |
| Email |
sales02@reliabpharma.com |
| Address |
Lane 1500, No.68, Xinfei Road, Songjiang District, Shanghai, China. |
| Contact |
Miss. Sucy |
| Telephone |
+86 755 27800161 |
| Email |
sales@todabio.com |
| Address |
5th Floor, Building 8, Changyuan New Material Port, No. 2, Gaoxin Zhongyi, Science and Technology Park, Nanshan District, Shenzhen |